C23H23N5O6 — CID 19586572
3,5-bis(3,4-dimethoxyphenyl)-1-[(4-nitropyrazol-1-yl)methyl]pyrazole (PubChem CID 19586572) has the molecular formula C23H23N5O6 and a molecular weight of 465.47 g/mol. Its IUPAC name is 3,5-bis(3,4-dimethoxyphenyl)-1-[(4-nitropyrazol-1-yl)methyl]pyrazole.
| Compound Name | 3,5-bis(3,4-dimethoxyphenyl)-1-[(4-nitropyrazol-1-yl)methyl]pyrazole |
|---|---|
| PubChem CID | 19586572 |
| Molecular Formula | C23H23N5O6 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 3,5-bis(3,4-dimethoxyphenyl)-1-[(4-nitropyrazol-1-yl)methyl]pyrazole |
| SMILES | COc1ccc(-c2cc(-c3ccc(OC)c(OC)c3)n(Cn3cc([N+](=O)[O-])cn3)n2)cc1OC |
| InChI | InChI=1S/C23H23N5O6/c1-31-20-7-5-15(9-22(20)33-3)18-11-19(16-6-8-21(32-2)23(10-16)34-4)27(25-18)14-26-13-17(12-24-26)28(29)30/h5-13H,14H2,1-4H3 |
| InChIKey | BMVVNUGAMQCPHW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 115.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|