C22H22N4O6 — CID 16885379
4-[3-(3,4-dimethoxyphenyl)-6-oxopyridazin-1-yl]-N-(2-nitrophenyl)butanamide (PubChem CID 16885379) has the molecular formula C22H22N4O6 and a molecular weight of 438.44 g/mol. Its IUPAC name is 4-[3-(3,4-dimethoxyphenyl)-6-oxopyridazin-1-yl]-N-(2-nitrophenyl)butanamide.
| Compound Name | 4-[3-(3,4-dimethoxyphenyl)-6-oxopyridazin-1-yl]-N-(2-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 16885379 |
| Molecular Formula | C22H22N4O6 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 4-[3-(3,4-dimethoxyphenyl)-6-oxopyridazin-1-yl]-N-(2-nitrophenyl)butanamide |
| SMILES | COc1ccc(-c2ccc(=O)n(CCCC(=O)Nc3ccccc3[N+](=O)[O-])n2)cc1OC |
| InChI | InChI=1S/C22H22N4O6/c1-31-19-11-9-15(14-20(19)32-2)16-10-12-22(28)25(24-16)13-5-8-21(27)23-17-6-3-4-7-18(17)26(29)30/h3-4,6-7,9-12,14H,5,8,13H2,1-2H3,(H,23,27) |
| InChIKey | QNSUAKXNSYSIMS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|