C28H27N3O5 — CID 16885465
4-[3-(3,4-dimethoxyphenyl)-6-oxopyridazin-1-yl]-N-(4-phenoxyphenyl)butanamide (PubChem CID 16885465) has the molecular formula C28H27N3O5 and a molecular weight of 485.54 g/mol. Its IUPAC name is 4-[3-(3,4-dimethoxyphenyl)-6-oxopyridazin-1-yl]-N-(4-phenoxyphenyl)butanamide.
| Compound Name | 4-[3-(3,4-dimethoxyphenyl)-6-oxopyridazin-1-yl]-N-(4-phenoxyphenyl)butanamide |
|---|---|
| PubChem CID | 16885465 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 4-[3-(3,4-dimethoxyphenyl)-6-oxopyridazin-1-yl]-N-(4-phenoxyphenyl)butanamide |
| SMILES | COc1ccc(-c2ccc(=O)n(CCCC(=O)Nc3ccc(Oc4ccccc4)cc3)n2)cc1OC |
| InChI | InChI=1S/C28H27N3O5/c1-34-25-16-10-20(19-26(25)35-2)24-15-17-28(33)31(30-24)18-6-9-27(32)29-21-11-13-23(14-12-21)36-22-7-4-3-5-8-22/h3-5,7-8,10-17,19H,6,9,18H2,1-2H3,(H,29,32) |
| InChIKey | QJKALOHPJJZULU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |