C27H17NO5S — CID 10322339
12-(benzenesulfonyl)-7-methoxynaphtho[3,2-a]carbazole-5,13-dione (PubChem CID 10322339) has the molecular formula C27H17NO5S and a molecular weight of 467.50 g/mol. Its IUPAC name is 12-(benzenesulfonyl)-7-methoxynaphtho[3,2-a]carbazole-5,13-dione.
| Compound Name | 12-(benzenesulfonyl)-7-methoxynaphtho[3,2-a]carbazole-5,13-dione |
|---|---|
| PubChem CID | 10322339 |
| Molecular Formula | C27H17NO5S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 12-(benzenesulfonyl)-7-methoxynaphtho[3,2-a]carbazole-5,13-dione |
| SMILES | COc1cc2c(c3c1c1ccccc1n3S(=O)(=O)c1ccccc1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H17NO5S/c1-33-22-15-20-24(27(30)18-12-6-5-11-17(18)26(20)29)25-23(22)19-13-7-8-14-21(19)28(25)34(31,32)16-9-3-2-4-10-16/h2-15H,1H3 |
| InChIKey | BZEAFJAHXODLSK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 82.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|