C22H15NO5S2 — CID 11797239
9-(benzenesulfonyl)-10-ethylsulfanylfuro[3,4-b]carbazole-1,3-dione (PubChem CID 11797239) has the molecular formula C22H15NO5S2 and a molecular weight of 437.50 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-10-ethylsulfanylfuro[3,4-b]carbazole-1,3-dione.
| Compound Name | 9-(benzenesulfonyl)-10-ethylsulfanylfuro[3,4-b]carbazole-1,3-dione |
|---|---|
| PubChem CID | 11797239 |
| Molecular Formula | C22H15NO5S2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 9-(benzenesulfonyl)-10-ethylsulfanylfuro[3,4-b]carbazole-1,3-dione |
| SMILES | CCSc1c2c(cc3c4ccccc4n(S(=O)(=O)c4ccccc4)c13)C(=O)OC2=O |
| InChI | InChI=1S/C22H15NO5S2/c1-2-29-20-18-16(21(24)28-22(18)25)12-15-14-10-6-7-11-17(14)23(19(15)20)30(26,27)13-8-4-3-5-9-13/h3-12H,2H2,1H3 |
| InChIKey | PQAQRFQLTHYUGO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 82.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|