C27H22N2O6S2 — CID 50936880
methyl 1-(5-ethylsulfanylcarbonylfuran-2-yl)-9-(4-methylphenyl)sulfonylpyrido[3,4-b]indole-3-carboxylate (PubChem CID 50936880) has the molecular formula C27H22N2O6S2 and a molecular weight of 534.62 g/mol. Its IUPAC name is methyl 1-(5-ethylsulfanylcarbonylfuran-2-yl)-9-(4-methylphenyl)sulfonylpyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 1-(5-ethylsulfanylcarbonylfuran-2-yl)-9-(4-methylphenyl)sulfonylpyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 50936880 |
| Molecular Formula | C27H22N2O6S2 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | methyl 1-(5-ethylsulfanylcarbonylfuran-2-yl)-9-(4-methylphenyl)sulfonylpyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCSC(=O)c1ccc(-c2nc(C(=O)OC)cc3c4ccccc4n(S(=O)(=O)c4ccc(C)cc4)c23)o1 |
| InChI | InChI=1S/C27H22N2O6S2/c1-4-36-27(31)23-14-13-22(35-23)24-25-19(15-20(28-24)26(30)34-3)18-7-5-6-8-21(18)29(25)37(32,33)17-11-9-16(2)10-12-17/h5-15H,4H2,1-3H3 |
| InChIKey | DVDAVVQMHGKDLQ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 108.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|