C13H11ClIN3O2S — CID 175965023
6-iodo-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidine;hydrochloride (PubChem CID 175965023) has the molecular formula C13H11ClIN3O2S and a molecular weight of 435.67 g/mol. Its IUPAC name is 6-iodo-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidine;hydrochloride.
| Compound Name | 6-iodo-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidine;hydrochloride |
|---|---|
| PubChem CID | 175965023 |
| Molecular Formula | C13H11ClIN3O2S |
| Molecular Weight | 435.67 g/mol |
| Exact Mass | 434.93 |
| IUPAC Name | 6-iodo-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidine;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)n2c(I)cc3cncnc32)cc1.Cl |
| InChI | InChI=1S/C13H10IN3O2S.ClH/c1-9-2-4-11(5-3-9)20(18,19)17-12(14)6-10-7-15-8-16-13(10)17;/h2-8H,1H3;1H |
| InChIKey | QRQPPPXZGWCZDE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.67 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|