C15H11BrN2O3S — CID 175864006
5-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine-2-carbaldehyde (PubChem CID 175864006) has the molecular formula C15H11BrN2O3S and a molecular weight of 379.24 g/mol. Its IUPAC name is 5-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine-2-carbaldehyde.
| Compound Name | 5-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 175864006 |
| Molecular Formula | C15H11BrN2O3S |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | 5-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine-2-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)n2c(C=O)cc3cc(Br)cnc32)cc1 |
| InChI | InChI=1S/C15H11BrN2O3S/c1-10-2-4-14(5-3-10)22(20,21)18-13(9-19)7-11-6-12(16)8-17-15(11)18/h2-9H,1H3 |
| InChIKey | PIFBGRJLOBNXPK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|