C16H11FN4O2S — CID 90909734
12-fluoro-8-methylsulfonyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 90909734) has the molecular formula C16H11FN4O2S and a molecular weight of 342.36 g/mol. Its IUPAC name is 12-fluoro-8-methylsulfonyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 12-fluoro-8-methylsulfonyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 90909734 |
| Molecular Formula | C16H11FN4O2S |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 12-fluoro-8-methylsulfonyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | CS(=O)(=O)n1c2cnc(-c3cccnc3)cc2c2cc(F)cnc21 |
| InChI | InChI=1S/C16H11FN4O2S/c1-24(22,23)21-15-9-19-14(10-3-2-4-18-7-10)6-12(15)13-5-11(17)8-20-16(13)21/h2-9H,1H3 |
| InChIKey | OKQXNCGSXZERSJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |