C9H17N3O4 — CID 142694259
2-[2-(3,5-dimethyl-4-oxo-1,3,5-triazinan-1-yl)ethoxy]acetic acid (PubChem CID 142694259) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-[2-(3,5-dimethyl-4-oxo-1,3,5-triazinan-1-yl)ethoxy]acetic acid.
| Compound Name | 2-[2-(3,5-dimethyl-4-oxo-1,3,5-triazinan-1-yl)ethoxy]acetic acid |
|---|---|
| PubChem CID | 142694259 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 2-[2-(3,5-dimethyl-4-oxo-1,3,5-triazinan-1-yl)ethoxy]acetic acid |
| SMILES | CN1CN(CCOCC(=O)O)CN(C)C1=O |
| InChI | InChI=1S/C9H17N3O4/c1-10-6-12(7-11(2)9(10)15)3-4-16-5-8(13)14/h3-7H2,1-2H3,(H,13,14) |
| InChIKey | GAHOYCFKVFAKGK-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|