C27H28F2N2O3 — CID 70143947
2-[2-[4-[bis(4-fluorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetic acid (PubChem CID 70143947) has the molecular formula C27H28F2N2O3 and a molecular weight of 466.53 g/mol. Its IUPAC name is 2-[2-[4-[bis(4-fluorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[4-[bis(4-fluorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 70143947 |
| Molecular Formula | C27H28F2N2O3 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 2-[2-[4-[bis(4-fluorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetic acid |
| SMILES | O=C(O)COCCN1CCN(C(c2ccccc2)(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H28F2N2O3/c28-24-10-6-22(7-11-24)27(21-4-2-1-3-5-21,23-8-12-25(29)13-9-23)31-16-14-30(15-17-31)18-19-34-20-26(32)33/h1-13H,14-20H2,(H,32,33) |
| InChIKey | JPXFUROTCGPGCF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|