C16H17F2O4P — CID 142697586
4-[3-(3,5-difluorophenoxy)phenyl]butylphosphonic acid (PubChem CID 142697586) has the molecular formula C16H17F2O4P and a molecular weight of 342.28 g/mol. Its IUPAC name is 4-[3-(3,5-difluorophenoxy)phenyl]butylphosphonic acid.
| Compound Name | 4-[3-(3,5-difluorophenoxy)phenyl]butylphosphonic acid |
|---|---|
| PubChem CID | 142697586 |
| Molecular Formula | C16H17F2O4P |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 4-[3-(3,5-difluorophenoxy)phenyl]butylphosphonic acid |
| SMILES | O=P(O)(O)CCCCc1cccc(Oc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C16H17F2O4P/c17-13-9-14(18)11-16(10-13)22-15-6-3-5-12(8-15)4-1-2-7-23(19,20)21/h3,5-6,8-11H,1-2,4,7H2,(H2,19,20,21) |
| InChIKey | HENHAHHGAASURB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|