C6H6F6O3S — CID 142698107
1,1,1,3,3,3-hexafluoropropan-2-yl prop-2-ene-1-sulfonate (PubChem CID 142698107) has the molecular formula C6H6F6O3S and a molecular weight of 272.17 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl prop-2-ene-1-sulfonate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl prop-2-ene-1-sulfonate |
|---|---|
| PubChem CID | 142698107 |
| Molecular Formula | C6H6F6O3S |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl prop-2-ene-1-sulfonate |
| SMILES | C=CCS(=O)(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H6F6O3S/c1-2-3-16(13,14)15-4(5(7,8)9)6(10,11)12/h2,4H,1,3H2 |
| InChIKey | ROPMSUVJYSEBGW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|