(3-hydroxynaphthalen-2-yl)oxyboronic acid

C10H9BO4 — CID 142698504

IUPAC(3-hydroxynaphthalen-2-yl)oxyboronic acid
SMILESOB(O)Oc1cc2ccccc2cc1O
InChIInChI=1S/C10H9BO4/c12-9-5-7-3-1-2-4-8(7)6-10(9)15-11(13)14/h1-6,12-14H
InChIKeyIKUCGPGVTXCWBC-UHFFFAOYSA-N
MW203.99 g/mol
LogP0.89
Rot. Bonds2

About (3-hydroxynaphthalen-2-yl)oxyboronic acid

(3-hydroxynaphthalen-2-yl)oxyboronic acid (PubChem CID 142698504) has the molecular formula C10H9BO4 and a molecular weight of 203.99 g/mol. Its IUPAC name is (3-hydroxynaphthalen-2-yl)oxyboronic acid.

Molecular Properties

Compound Name(3-hydroxynaphthalen-2-yl)oxyboronic acid
PubChem CID142698504
Molecular FormulaC10H9BO4
Molecular Weight203.99 g/mol
Exact Mass204.06
IUPAC Name(3-hydroxynaphthalen-2-yl)oxyboronic acid
SMILESOB(O)Oc1cc2ccccc2cc1O
InChIInChI=1S/C10H9BO4/c12-9-5-7-3-1-2-4-8(7)6-10(9)15-11(13)14/h1-6,12-14H
InChIKeyIKUCGPGVTXCWBC-UHFFFAOYSA-N
XLogP0.89
TPSA69.92 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.99
LogP ≤ 50.89
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (3-hydroxynaphthalen-2-yl)oxyboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-hydroxynaphthalen-2-yl)oxyboronic acid?
The IUPAC name of (3-hydroxynaphthalen-2-yl)oxyboronic acid (CID 142698504) is (3-hydroxynaphthalen-2-yl)oxyboronic acid.
What is the SMILES notation for (3-hydroxynaphthalen-2-yl)oxyboronic acid?
The canonical SMILES for (3-hydroxynaphthalen-2-yl)oxyboronic acid is OB(O)Oc1cc2ccccc2cc1O.
What is the InChIKey of (3-hydroxynaphthalen-2-yl)oxyboronic acid?
The InChIKey is IKUCGPGVTXCWBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BO4/c12-9-5-7-3-1-2-4-8(7)6-10(9)15-11(13)14/h1-6,12-14H.
What are the key properties of (3-hydroxynaphthalen-2-yl)oxyboronic acid?
(3-hydroxynaphthalen-2-yl)oxyboronic acid has a molecular weight of 203.99 g/mol, XLogP of 0.89, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxynaphthalen-2-yl)oxyboronic acid is sourced from PubChem (CID 142698504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).