C24H29N5O5 — CID 142700541
1-(3,7-dimethoxyquinoxalin-2-yl)-3-[1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]urea (PubChem CID 142700541) has the molecular formula C24H29N5O5 and a molecular weight of 467.53 g/mol. Its IUPAC name is 1-(3,7-dimethoxyquinoxalin-2-yl)-3-[1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]urea.
| Compound Name | 1-(3,7-dimethoxyquinoxalin-2-yl)-3-[1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 142700541 |
| Molecular Formula | C24H29N5O5 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 1-(3,7-dimethoxyquinoxalin-2-yl)-3-[1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]urea |
| SMILES | COc1ccc(CN2CCC(NC(=O)Nc3nc4cc(OC)ccc4nc3OC)CC2)c(O)c1 |
| InChI | InChI=1S/C24H29N5O5/c1-32-17-6-7-19-20(12-17)26-22(23(27-19)34-3)28-24(31)25-16-8-10-29(11-9-16)14-15-4-5-18(33-2)13-21(15)30/h4-7,12-13,16,30H,8-11,14H2,1-3H3,(H2,25,26,28,31) |
| InChIKey | PZUVZOJBPVIMBS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 118.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|