C6H15N3O — CID 142701780
4-N,4-N-dimethylmorpholine-3,4-diamine (PubChem CID 142701780) has the molecular formula C6H15N3O and a molecular weight of 145.21 g/mol. Its IUPAC name is 4-N,4-N-dimethylmorpholine-3,4-diamine.
| Compound Name | 4-N,4-N-dimethylmorpholine-3,4-diamine |
|---|---|
| PubChem CID | 142701780 |
| Molecular Formula | C6H15N3O |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.12 |
| IUPAC Name | 4-N,4-N-dimethylmorpholine-3,4-diamine |
| SMILES | CN(C)N1CCOCC1N |
| InChI | InChI=1S/C6H15N3O/c1-8(2)9-3-4-10-5-6(9)7/h6H,3-5,7H2,1-2H3 |
| InChIKey | FMTWKNMNGCKWTD-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |