About methyl 2-fluoro-4-[5-(3-methyl-4-piperidin-1-ylphenyl)-1,2-oxazol-3-yl]benzoate
methyl 2-fluoro-4-[5-(3-methyl-4-piperidin-1-ylphenyl)-1,2-oxazol-3-yl]benzoate (PubChem CID 142703523) has the molecular formula C23H23FN2O3
and a molecular weight of 394.45 g/mol. Its IUPAC name is methyl 2-fluoro-4-[5-(3-methyl-4-piperidin-1-ylphenyl)-1,2-oxazol-3-yl]benzoate.
Molecular Properties
| Compound Name | methyl 2-fluoro-4-[5-(3-methyl-4-piperidin-1-ylphenyl)-1,2-oxazol-3-yl]benzoate |
| PubChem CID | 142703523 |
| Molecular Formula | C23H23FN2O3 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | methyl 2-fluoro-4-[5-(3-methyl-4-piperidin-1-ylphenyl)-1,2-oxazol-3-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cc(-c3ccc(N4CCCCC4)c(C)c3)on2)cc1F |
| InChI | InChI=1S/C23H23FN2O3/c1-15-12-17(7-9-21(15)26-10-4-3-5-11-26)22-14-20(25-29-22)16-6-8-18(19(24)13-16)23(27)28-2/h6-9,12-14H,3-5,10-11H2,1-2H3 |
| InChIKey | UVKGPODZVROZFQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-fluoro-4-[5-(3-methyl-4-piperidin-1-ylphenyl)-1,2-oxazol-3-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-fluoro-4-[5-(3-methyl-4-piperidin-1-ylphenyl)-1,2-oxazol-3-yl]benzoate?
The IUPAC name of methyl 2-fluoro-4-[5-(3-methyl-4-piperidin-1-ylphenyl)-1,2-oxazol-3-yl]benzoate (CID 142703523) is methyl 2-fluoro-4-[5-(3-methyl-4-piperidin-1-ylphenyl)-1,2-oxazol-3-yl]benzoate.
What is the SMILES notation for methyl 2-fluoro-4-[5-(3-methyl-4-piperidin-1-ylphenyl)-1,2-oxazol-3-yl]benzoate?
The canonical SMILES for methyl 2-fluoro-4-[5-(3-methyl-4-piperidin-1-ylphenyl)-1,2-oxazol-3-yl]benzoate is COC(=O)c1ccc(-c2cc(-c3ccc(N4CCCCC4)c(C)c3)on2)cc1F.
What is the InChIKey of methyl 2-fluoro-4-[5-(3-methyl-4-piperidin-1-ylphenyl)-1,2-oxazol-3-yl]benzoate?
The InChIKey is UVKGPODZVROZFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23FN2O3/c1-15-12-17(7-9-21(15)26-10-4-3-5-11-26)22-14-20(25-29-22)16-6-8-18(19(24)13-16)23(27)28-2/h6-9,12-14H,3-5,10-11H2,1-2H3.
What are the key properties of methyl 2-fluoro-4-[5-(3-methyl-4-piperidin-1-ylphenyl)-1,2-oxazol-3-yl]benzoate?
methyl 2-fluoro-4-[5-(3-methyl-4-piperidin-1-ylphenyl)-1,2-oxazol-3-yl]benzoate has a molecular weight of 394.45 g/mol, XLogP of 5.23, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-fluoro-4-[5-(3-methyl-4-piperidin-1-ylphenyl)-1,2-oxazol-3-yl]benzoate is sourced from PubChem (CID 142703523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).