C27H35NO2 — CID 142705312
[4,4-bis(4-butylphenoxy)cyclohexa-1,5-dien-1-yl]methanamine (PubChem CID 142705312) has the molecular formula C27H35NO2 and a molecular weight of 405.58 g/mol. Its IUPAC name is [4,4-bis(4-butylphenoxy)cyclohexa-1,5-dien-1-yl]methanamine.
| Compound Name | [4,4-bis(4-butylphenoxy)cyclohexa-1,5-dien-1-yl]methanamine |
|---|---|
| PubChem CID | 142705312 |
| Molecular Formula | C27H35NO2 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | [4,4-bis(4-butylphenoxy)cyclohexa-1,5-dien-1-yl]methanamine |
| SMILES | CCCCc1ccc(OC2(Oc3ccc(CCCC)cc3)C=CC(CN)=CC2)cc1 |
| InChI | InChI=1S/C27H35NO2/c1-3-5-7-22-9-13-25(14-10-22)29-27(19-17-24(21-28)18-20-27)30-26-15-11-23(12-16-26)8-6-4-2/h9-19H,3-8,20-21,28H2,1-2H3 |
| InChIKey | REWNJLQPMQSJDB-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|