C18H26N2O3 — CID 142705382
ethyl 2-(2-benzoylhydrazinyl)-2-cyclohexylpropanoate (PubChem CID 142705382) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is ethyl 2-(2-benzoylhydrazinyl)-2-cyclohexylpropanoate.
| Compound Name | ethyl 2-(2-benzoylhydrazinyl)-2-cyclohexylpropanoate |
|---|---|
| PubChem CID | 142705382 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | ethyl 2-(2-benzoylhydrazinyl)-2-cyclohexylpropanoate |
| SMILES | CCOC(=O)C(C)(NNC(=O)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C18H26N2O3/c1-3-23-17(22)18(2,15-12-8-5-9-13-15)20-19-16(21)14-10-6-4-7-11-14/h4,6-7,10-11,15,20H,3,5,8-9,12-13H2,1-2H3,(H,19,21) |
| InChIKey | SUEFCQRZFRLTRS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|