C21H32O3 — CID 174492804
ethyl 2-cyclohexyl-2-hydroxy-3,4-dimethyl-4-phenylpentanoate (PubChem CID 174492804) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is ethyl 2-cyclohexyl-2-hydroxy-3,4-dimethyl-4-phenylpentanoate.
| Compound Name | ethyl 2-cyclohexyl-2-hydroxy-3,4-dimethyl-4-phenylpentanoate |
|---|---|
| PubChem CID | 174492804 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | ethyl 2-cyclohexyl-2-hydroxy-3,4-dimethyl-4-phenylpentanoate |
| SMILES | CCOC(=O)C(O)(C1CCCCC1)C(C)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H32O3/c1-5-24-19(22)21(23,18-14-10-7-11-15-18)16(2)20(3,4)17-12-8-6-9-13-17/h6,8-9,12-13,16,18,23H,5,7,10-11,14-15H2,1-4H3 |
| InChIKey | YFSBPXWPPIWQRW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |