C21H31NO4 — CID 170322469
(2-cyclohexyl-2-ethoxy-2-phenylacetyl) (2R)-2-amino-3-methylbutanoate (PubChem CID 170322469) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is (2-cyclohexyl-2-ethoxy-2-phenylacetyl) (2R)-2-amino-3-methylbutanoate.
| Compound Name | (2-cyclohexyl-2-ethoxy-2-phenylacetyl) (2R)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 170322469 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | (2-cyclohexyl-2-ethoxy-2-phenylacetyl) (2R)-2-amino-3-methylbutanoate |
| SMILES | CCOC(C(=O)OC(=O)[C@H](N)C(C)C)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C21H31NO4/c1-4-25-21(16-11-7-5-8-12-16,17-13-9-6-10-14-17)20(24)26-19(23)18(22)15(2)3/h5,7-8,11-12,15,17-18H,4,6,9-10,13-14,22H2,1-3H3/t18-,21?/m1/s1 |
| InChIKey | DCNKGQYTFBYUOL-ITUIMRKVSA-N |
| XLogP | 3.55 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|