C26H33NO2 — CID 95560277
ethyl 2-[(3S)-1-cyclohexylpyrrolidin-3-yl]-2,2-diphenylacetate (PubChem CID 95560277) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is ethyl 2-[(3S)-1-cyclohexylpyrrolidin-3-yl]-2,2-diphenylacetate.
| Compound Name | ethyl 2-[(3S)-1-cyclohexylpyrrolidin-3-yl]-2,2-diphenylacetate |
|---|---|
| PubChem CID | 95560277 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | ethyl 2-[(3S)-1-cyclohexylpyrrolidin-3-yl]-2,2-diphenylacetate |
| SMILES | CCOC(=O)C(c1ccccc1)(c1ccccc1)[C@@H]1CCN(C2CCCCC2)C1 |
| InChI | InChI=1S/C26H33NO2/c1-2-29-25(28)26(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-18-19-27(20-23)24-16-10-5-11-17-24/h3-4,6-9,12-15,23-24H,2,5,10-11,16-20H2,1H3/t23-/m1/s1 |
| InChIKey | WQYRLUGDFUKNQQ-HSZRJFAPSA-N |
| XLogP | 5.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |