C19H24N2O3 — CID 142705759
tert-butyl N-[2-[[(1S)-1-cyano-2-oxocyclopentyl]methyl]-5-methylphenyl]carbamate (PubChem CID 142705759) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is tert-butyl N-[2-[[(1S)-1-cyano-2-oxocyclopentyl]methyl]-5-methylphenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(1S)-1-cyano-2-oxocyclopentyl]methyl]-5-methylphenyl]carbamate |
|---|---|
| PubChem CID | 142705759 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | tert-butyl N-[2-[[(1S)-1-cyano-2-oxocyclopentyl]methyl]-5-methylphenyl]carbamate |
| SMILES | Cc1ccc(C[C@]2(C#N)CCCC2=O)c(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C19H24N2O3/c1-13-7-8-14(11-19(12-20)9-5-6-16(19)22)15(10-13)21-17(23)24-18(2,3)4/h7-8,10H,5-6,9,11H2,1-4H3,(H,21,23)/t19-/m0/s1 |
| InChIKey | IWEMJTATXHYPQY-IBGZPJMESA-N |
| XLogP | 4.15 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |