C19H29N3O — CID 142706599
(2R)-2-phenyl-4-(3-piperidin-1-ylpropyl)-1,4-diazepan-5-one (PubChem CID 142706599) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is (2R)-2-phenyl-4-(3-piperidin-1-ylpropyl)-1,4-diazepan-5-one.
| Compound Name | (2R)-2-phenyl-4-(3-piperidin-1-ylpropyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 142706599 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | (2R)-2-phenyl-4-(3-piperidin-1-ylpropyl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN[C@H](c2ccccc2)CN1CCCN1CCCCC1 |
| InChI | InChI=1S/C19H29N3O/c23-19-10-11-20-18(17-8-3-1-4-9-17)16-22(19)15-7-14-21-12-5-2-6-13-21/h1,3-4,8-9,18,20H,2,5-7,10-16H2/t18-/m0/s1 |
| InChIKey | IORJZWSQWXBWGH-SFHVURJKSA-N |
| XLogP | 2.43 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |