C19H22F3N3O3S — CID 142707581
N-[4-methoxy-3-[[3-(trifluoromethyl)piperidin-1-yl]amino]phenyl]benzenesulfonamide (PubChem CID 142707581) has the molecular formula C19H22F3N3O3S and a molecular weight of 429.46 g/mol. Its IUPAC name is N-[4-methoxy-3-[[3-(trifluoromethyl)piperidin-1-yl]amino]phenyl]benzenesulfonamide.
| Compound Name | N-[4-methoxy-3-[[3-(trifluoromethyl)piperidin-1-yl]amino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 142707581 |
| Molecular Formula | C19H22F3N3O3S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | N-[4-methoxy-3-[[3-(trifluoromethyl)piperidin-1-yl]amino]phenyl]benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccccc2)cc1NN1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C19H22F3N3O3S/c1-28-18-10-9-15(24-29(26,27)16-7-3-2-4-8-16)12-17(18)23-25-11-5-6-14(13-25)19(20,21)22/h2-4,7-10,12,14,23-24H,5-6,11,13H2,1H3 |
| InChIKey | CYGDMOMFFHVCLI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |