C15H19N3O5S2 — CID 21239388
N-[4-(dimethylsulfamoylamino)-2-methoxyphenyl]benzenesulfonamide (PubChem CID 21239388) has the molecular formula C15H19N3O5S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is N-[4-(dimethylsulfamoylamino)-2-methoxyphenyl]benzenesulfonamide.
| Compound Name | N-[4-(dimethylsulfamoylamino)-2-methoxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 21239388 |
| Molecular Formula | C15H19N3O5S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | N-[4-(dimethylsulfamoylamino)-2-methoxyphenyl]benzenesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)N(C)C)ccc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H19N3O5S2/c1-18(2)25(21,22)16-12-9-10-14(15(11-12)23-3)17-24(19,20)13-7-5-4-6-8-13/h4-11,16-17H,1-3H3 |
| InChIKey | QFBWHIGYQGBCFA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'} |
|---|