About thiomorpholin-4-yl thiomorpholin-4-yloxysulfonyl sulfate
thiomorpholin-4-yl thiomorpholin-4-yloxysulfonyl sulfate (PubChem CID 142709456) has the molecular formula C8H16N2O7S4
and a molecular weight of 380.49 g/mol. Its IUPAC name is thiomorpholin-4-yl thiomorpholin-4-yloxysulfonyl sulfate.
Molecular Properties
| Compound Name | thiomorpholin-4-yl thiomorpholin-4-yloxysulfonyl sulfate |
| PubChem CID | 142709456 |
| Molecular Formula | C8H16N2O7S4 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | thiomorpholin-4-yl thiomorpholin-4-yloxysulfonyl sulfate |
| SMILES | O=S(=O)(ON1CCSCC1)OS(=O)(=O)ON1CCSCC1 |
| InChI | InChI=1S/C8H16N2O7S4/c11-20(12,15-9-1-5-18-6-2-9)17-21(13,14)16-10-3-7-19-8-4-10/h1-8H2 |
| InChIKey | XRFMLRPCCAJWJM-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Analyze thiomorpholin-4-yl thiomorpholin-4-yloxysulfonyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiomorpholin-4-yl thiomorpholin-4-yloxysulfonyl sulfate?
The IUPAC name of thiomorpholin-4-yl thiomorpholin-4-yloxysulfonyl sulfate (CID 142709456) is thiomorpholin-4-yl thiomorpholin-4-yloxysulfonyl sulfate.
What is the SMILES notation for thiomorpholin-4-yl thiomorpholin-4-yloxysulfonyl sulfate?
The canonical SMILES for thiomorpholin-4-yl thiomorpholin-4-yloxysulfonyl sulfate is O=S(=O)(ON1CCSCC1)OS(=O)(=O)ON1CCSCC1.
What is the InChIKey of thiomorpholin-4-yl thiomorpholin-4-yloxysulfonyl sulfate?
The InChIKey is XRFMLRPCCAJWJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O7S4/c11-20(12,15-9-1-5-18-6-2-9)17-21(13,14)16-10-3-7-19-8-4-10/h1-8H2.
What are the key properties of thiomorpholin-4-yl thiomorpholin-4-yloxysulfonyl sulfate?
thiomorpholin-4-yl thiomorpholin-4-yloxysulfonyl sulfate has a molecular weight of 380.49 g/mol, XLogP of -0.55, 6 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for thiomorpholin-4-yl thiomorpholin-4-yloxysulfonyl sulfate is sourced from PubChem (CID 142709456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).