C18H19ClN2OS — CID 142709519
N-[4-(4-chlorophenyl)-5-ethyl-1,3-thiazol-2-yl]cyclohex-3-ene-1-carboxamide (PubChem CID 142709519) has the molecular formula C18H19ClN2OS and a molecular weight of 346.88 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-5-ethyl-1,3-thiazol-2-yl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[4-(4-chlorophenyl)-5-ethyl-1,3-thiazol-2-yl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 142709519 |
| Molecular Formula | C18H19ClN2OS |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-[4-(4-chlorophenyl)-5-ethyl-1,3-thiazol-2-yl]cyclohex-3-ene-1-carboxamide |
| SMILES | CCc1sc(NC(=O)C2CC=CCC2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19ClN2OS/c1-2-15-16(12-8-10-14(19)11-9-12)20-18(23-15)21-17(22)13-6-4-3-5-7-13/h3-4,8-11,13H,2,5-7H2,1H3,(H,20,21,22) |
| InChIKey | NJSBAJRSAMHFOV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|