C18H18ClNO2 — CID 40972536
(1R)-N-[[5-(4-chlorophenyl)furan-2-yl]methyl]cyclohex-3-ene-1-carboxamide (PubChem CID 40972536) has the molecular formula C18H18ClNO2 and a molecular weight of 315.80 g/mol. Its IUPAC name is (1R)-N-[[5-(4-chlorophenyl)furan-2-yl]methyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R)-N-[[5-(4-chlorophenyl)furan-2-yl]methyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 40972536 |
| Molecular Formula | C18H18ClNO2 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (1R)-N-[[5-(4-chlorophenyl)furan-2-yl]methyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NCc1ccc(-c2ccc(Cl)cc2)o1)[C@H]1CC=CCC1 |
| InChI | InChI=1S/C18H18ClNO2/c19-15-8-6-13(7-9-15)17-11-10-16(22-17)12-20-18(21)14-4-2-1-3-5-14/h1-2,6-11,14H,3-5,12H2,(H,20,21)/t14-/m0/s1 |
| InChIKey | AVTMTNYAXUTDRY-AWEZNQCLSA-N |
| XLogP | 4.57 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|