C18H14ClNO5 — CID 26985367
[2-[[5-(4-chlorophenyl)furan-2-yl]methylamino]-2-oxoethyl] furan-3-carboxylate (PubChem CID 26985367) has the molecular formula C18H14ClNO5 and a molecular weight of 359.77 g/mol. Its IUPAC name is [2-[[5-(4-chlorophenyl)furan-2-yl]methylamino]-2-oxoethyl] furan-3-carboxylate.
| Compound Name | [2-[[5-(4-chlorophenyl)furan-2-yl]methylamino]-2-oxoethyl] furan-3-carboxylate |
|---|---|
| PubChem CID | 26985367 |
| Molecular Formula | C18H14ClNO5 |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | [2-[[5-(4-chlorophenyl)furan-2-yl]methylamino]-2-oxoethyl] furan-3-carboxylate |
| SMILES | O=C(COC(=O)c1ccoc1)NCc1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C18H14ClNO5/c19-14-3-1-12(2-4-14)16-6-5-15(25-16)9-20-17(21)11-24-18(22)13-7-8-23-10-13/h1-8,10H,9,11H2,(H,20,21) |
| InChIKey | WGLZINMZVCKOIJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 81.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |