C21H18ClN3O6S — CID 55370578
[2-[[5-(4-chlorophenyl)furan-2-yl]methylamino]-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate (PubChem CID 55370578) has the molecular formula C21H18ClN3O6S and a molecular weight of 475.91 g/mol. Its IUPAC name is [2-[[5-(4-chlorophenyl)furan-2-yl]methylamino]-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate.
| Compound Name | [2-[[5-(4-chlorophenyl)furan-2-yl]methylamino]-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
|---|---|
| PubChem CID | 55370578 |
| Molecular Formula | C21H18ClN3O6S |
| Molecular Weight | 475.91 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | [2-[[5-(4-chlorophenyl)furan-2-yl]methylamino]-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
| SMILES | O=C(COC(=O)C1=CN2CCS(=O)(=O)N=C2C=C1)NCc1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C21H18ClN3O6S/c22-16-4-1-14(2-5-16)18-7-6-17(31-18)11-23-20(26)13-30-21(27)15-3-8-19-24-32(28,29)10-9-25(19)12-15/h1-8,12H,9-11,13H2,(H,23,26) |
| InChIKey | GABVNZKDIMIMRF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.91 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |