C21H24ClN3O4 — CID 9480365
4-(4-acetylpiperazin-1-yl)-N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-4-oxobutanamide (PubChem CID 9480365) has the molecular formula C21H24ClN3O4 and a molecular weight of 417.89 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)-N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-4-oxobutanamide.
| Compound Name | 4-(4-acetylpiperazin-1-yl)-N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 9480365 |
| Molecular Formula | C21H24ClN3O4 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)-N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-4-oxobutanamide |
| SMILES | CC(=O)N1CCN(C(=O)CCC(=O)NCc2ccc(-c3ccc(Cl)cc3)o2)CC1 |
| InChI | InChI=1S/C21H24ClN3O4/c1-15(26)24-10-12-25(13-11-24)21(28)9-8-20(27)23-14-18-6-7-19(29-18)16-2-4-17(22)5-3-16/h2-7H,8-14H2,1H3,(H,23,27) |
| InChIKey | GWALPJIYAQPZKJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |