C18H17N5O5S2 — CID 42379034
N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide (PubChem CID 42379034) has the molecular formula C18H17N5O5S2 and a molecular weight of 447.50 g/mol. Its IUPAC name is N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide.
| Compound Name | N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 42379034 |
| Molecular Formula | C18H17N5O5S2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
| SMILES | CC(=O)NCc1ccc(-c2csc(NC(=O)C3=CN4CCS(=O)(=O)N=C4C=C3)n2)o1 |
| InChI | InChI=1S/C18H17N5O5S2/c1-11(24)19-8-13-3-4-15(28-13)14-10-29-18(20-14)21-17(25)12-2-5-16-22-30(26,27)7-6-23(16)9-12/h2-5,9-10H,6-8H2,1H3,(H,19,24)(H,20,21,25) |
| InChIKey | OIXFNQMJKVOZDP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 133.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |