C15H15N3O6S — CID 55371145
[2-(furan-2-ylmethylamino)-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate (PubChem CID 55371145) has the molecular formula C15H15N3O6S and a molecular weight of 365.37 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
|---|---|
| PubChem CID | 55371145 |
| Molecular Formula | C15H15N3O6S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
| SMILES | O=C(COC(=O)C1=CN2CCS(=O)(=O)N=C2C=C1)NCc1ccco1 |
| InChI | InChI=1S/C15H15N3O6S/c19-14(16-8-12-2-1-6-23-12)10-24-15(20)11-3-4-13-17-25(21,22)7-5-18(13)9-11/h1-4,6,9H,5,7-8,10H2,(H,16,19) |
| InChIKey | YDTJXXAIOVXXOW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |