C16H12ClF3N4O5S — CID 55371151
[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate (PubChem CID 55371151) has the molecular formula C16H12ClF3N4O5S and a molecular weight of 464.81 g/mol. Its IUPAC name is [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate.
| Compound Name | [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
|---|---|
| PubChem CID | 55371151 |
| Molecular Formula | C16H12ClF3N4O5S |
| Molecular Weight | 464.81 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
| SMILES | O=C(COC(=O)C1=CN2CCS(=O)(=O)N=C2C=C1)Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C16H12ClF3N4O5S/c17-11-5-10(16(18,19)20)6-21-14(11)22-13(25)8-29-15(26)9-1-2-12-23-30(27,28)4-3-24(12)7-9/h1-2,5-7H,3-4,8H2,(H,21,22,25) |
| InChIKey | CDZMNGPAGSAKPA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 118.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.81 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |