C15H32O2 — CID 142709822
4,5-bis(methoxymethyl)-2,2-dimethylnonane (PubChem CID 142709822) has the molecular formula C15H32O2 and a molecular weight of 244.42 g/mol. Its IUPAC name is 4,5-bis(methoxymethyl)-2,2-dimethylnonane.
| Compound Name | 4,5-bis(methoxymethyl)-2,2-dimethylnonane |
|---|---|
| PubChem CID | 142709822 |
| Molecular Formula | C15H32O2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.24 |
| IUPAC Name | 4,5-bis(methoxymethyl)-2,2-dimethylnonane |
| SMILES | CCCCC(COC)C(COC)CC(C)(C)C |
| InChI | InChI=1S/C15H32O2/c1-7-8-9-13(11-16-5)14(12-17-6)10-15(2,3)4/h13-14H,7-12H2,1-6H3 |
| InChIKey | JBJMWWKLWMCYOW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |