C16H17ClN4O3 — CID 142710470
3-chloro-N-[6-(4-methoxyphenyl)-7-oxo-4,5-dihydro-1H-pyrazolo[5,4-c]pyridin-3-yl]propanamide (PubChem CID 142710470) has the molecular formula C16H17ClN4O3 and a molecular weight of 348.79 g/mol. Its IUPAC name is 3-chloro-N-[6-(4-methoxyphenyl)-7-oxo-4,5-dihydro-1H-pyrazolo[5,4-c]pyridin-3-yl]propanamide.
| Compound Name | 3-chloro-N-[6-(4-methoxyphenyl)-7-oxo-4,5-dihydro-1H-pyrazolo[5,4-c]pyridin-3-yl]propanamide |
|---|---|
| PubChem CID | 142710470 |
| Molecular Formula | C16H17ClN4O3 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 3-chloro-N-[6-(4-methoxyphenyl)-7-oxo-4,5-dihydro-1H-pyrazolo[5,4-c]pyridin-3-yl]propanamide |
| SMILES | COc1ccc(N2CCc3c(NC(=O)CCCl)n[nH]c3C2=O)cc1 |
| InChI | InChI=1S/C16H17ClN4O3/c1-24-11-4-2-10(3-5-11)21-9-7-12-14(16(21)23)19-20-15(12)18-13(22)6-8-17/h2-5H,6-9H2,1H3,(H2,18,19,20,22) |
| InChIKey | HLLZJRCIOVISJG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|