C22H32N4O2 — CID 24998042
5-(azepan-1-yl)-N-[5-(4-methoxyphenyl)-4-methyl-1H-pyrazol-3-yl]pentanamide (PubChem CID 24998042) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 5-(azepan-1-yl)-N-[5-(4-methoxyphenyl)-4-methyl-1H-pyrazol-3-yl]pentanamide.
| Compound Name | 5-(azepan-1-yl)-N-[5-(4-methoxyphenyl)-4-methyl-1H-pyrazol-3-yl]pentanamide |
|---|---|
| PubChem CID | 24998042 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 5-(azepan-1-yl)-N-[5-(4-methoxyphenyl)-4-methyl-1H-pyrazol-3-yl]pentanamide |
| SMILES | COc1ccc(-c2[nH]nc(NC(=O)CCCCN3CCCCCC3)c2C)cc1 |
| InChI | InChI=1S/C22H32N4O2/c1-17-21(18-10-12-19(28-2)13-11-18)24-25-22(17)23-20(27)9-5-8-16-26-14-6-3-4-7-15-26/h10-13H,3-9,14-16H2,1-2H3,(H2,23,24,25,27) |
| InChIKey | VSCCIMABJBSTPH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|