C32H38N2O7 — CID 142710777
(2E)-N-[(3S)-4-(benzylamino)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]-2-[[3,4-bis(methoxymethoxy)phenyl]methylidene]butanamide (PubChem CID 142710777) has the molecular formula C32H38N2O7 and a molecular weight of 562.66 g/mol. Its IUPAC name is (2E)-N-[(3S)-4-(benzylamino)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]-2-[[3,4-bis(methoxymethoxy)phenyl]methylidene]butanamide.
| Compound Name | (2E)-N-[(3S)-4-(benzylamino)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]-2-[[3,4-bis(methoxymethoxy)phenyl]methylidene]butanamide |
|---|---|
| PubChem CID | 142710777 |
| Molecular Formula | C32H38N2O7 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.27 |
| IUPAC Name | (2E)-N-[(3S)-4-(benzylamino)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]-2-[[3,4-bis(methoxymethoxy)phenyl]methylidene]butanamide |
| SMILES | CC/C(=C\c1ccc(OCOC)c(OCOC)c1)C(=O)NC(Cc1ccccc1)[C@H](O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C32H38N2O7/c1-4-26(17-25-15-16-28(40-21-38-2)29(19-25)41-22-39-3)31(36)34-27(18-23-11-7-5-8-12-23)30(35)32(37)33-20-24-13-9-6-10-14-24/h5-17,19,27,30,35H,4,18,20-22H2,1-3H3,(H,33,37)(H,34,36)/b26-17+/t27?,30-/m0/s1 |
| InChIKey | WFPOKLBCZQXNLW-KVCDZJAISA-N |
| XLogP | 3.85 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|