C30H30N2O7 — CID 170457534
N-[(2S)-4-(benzylamino)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]-7-(methoxymethoxy)-3-methyl-4-oxochromene-2-carboxamide (PubChem CID 170457534) has the molecular formula C30H30N2O7 and a molecular weight of 530.58 g/mol. Its IUPAC name is N-[(2S)-4-(benzylamino)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]-7-(methoxymethoxy)-3-methyl-4-oxochromene-2-carboxamide.
| Compound Name | N-[(2S)-4-(benzylamino)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]-7-(methoxymethoxy)-3-methyl-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 170457534 |
| Molecular Formula | C30H30N2O7 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | N-[(2S)-4-(benzylamino)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]-7-(methoxymethoxy)-3-methyl-4-oxochromene-2-carboxamide |
| SMILES | COCOc1ccc2c(=O)c(C)c(C(=O)N[C@@H](Cc3ccccc3)C(O)C(=O)NCc3ccccc3)oc2c1 |
| InChI | InChI=1S/C30H30N2O7/c1-19-26(33)23-14-13-22(38-18-37-2)16-25(23)39-28(19)30(36)32-24(15-20-9-5-3-6-10-20)27(34)29(35)31-17-21-11-7-4-8-12-21/h3-14,16,24,27,34H,15,17-18H2,1-2H3,(H,31,35)(H,32,36)/t24-,27?/m0/s1 |
| InChIKey | RXYOGOWCCGDZDE-BXXZMZEQSA-N |
| XLogP | 3.10 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|