C16H38N2O2Si — CID 142710808
2-[[1-(dimethylamino)-2-methylbutan-2-yl]oxy-dimethylsilyl]oxy-N,N,2-trimethylbutan-1-amine (PubChem CID 142710808) has the molecular formula C16H38N2O2Si and a molecular weight of 318.58 g/mol. Its IUPAC name is 2-[[1-(dimethylamino)-2-methylbutan-2-yl]oxy-dimethylsilyl]oxy-N,N,2-trimethylbutan-1-amine.
| Compound Name | 2-[[1-(dimethylamino)-2-methylbutan-2-yl]oxy-dimethylsilyl]oxy-N,N,2-trimethylbutan-1-amine |
|---|---|
| PubChem CID | 142710808 |
| Molecular Formula | C16H38N2O2Si |
| Molecular Weight | 318.58 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | 2-[[1-(dimethylamino)-2-methylbutan-2-yl]oxy-dimethylsilyl]oxy-N,N,2-trimethylbutan-1-amine |
| SMILES | CCC(C)(CN(C)C)O[Si](C)(C)OC(C)(CC)CN(C)C |
| InChI | InChI=1S/C16H38N2O2Si/c1-11-15(3,13-17(5)6)19-21(9,10)20-16(4,12-2)14-18(7)8/h11-14H2,1-10H3 |
| InChIKey | RRXDFEBYQSSZRE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|