C10H25NOSi — CID 142710805
N,N,2-trimethyl-2-trimethylsilyloxybutan-1-amine (PubChem CID 142710805) has the molecular formula C10H25NOSi and a molecular weight of 203.40 g/mol. Its IUPAC name is N,N,2-trimethyl-2-trimethylsilyloxybutan-1-amine.
| Compound Name | N,N,2-trimethyl-2-trimethylsilyloxybutan-1-amine |
|---|---|
| PubChem CID | 142710805 |
| Molecular Formula | C10H25NOSi |
| Molecular Weight | 203.40 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N,N,2-trimethyl-2-trimethylsilyloxybutan-1-amine |
| SMILES | CCC(C)(CN(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C10H25NOSi/c1-8-10(2,9-11(3)4)12-13(5,6)7/h8-9H2,1-7H3 |
| InChIKey | VKLDGRTUTYTDKC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|