C10H24OSi — CID 10679187
2,3-dimethylpentan-3-yloxy(trimethyl)silane (PubChem CID 10679187) has the molecular formula C10H24OSi and a molecular weight of 188.39 g/mol. Its IUPAC name is 2,3-dimethylpentan-3-yloxy(trimethyl)silane.
| Compound Name | 2,3-dimethylpentan-3-yloxy(trimethyl)silane |
|---|---|
| PubChem CID | 10679187 |
| Molecular Formula | C10H24OSi |
| Molecular Weight | 188.39 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 2,3-dimethylpentan-3-yloxy(trimethyl)silane |
| SMILES | CCC(C)(O[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C10H24OSi/c1-8-10(4,9(2)3)11-12(5,6)7/h9H,8H2,1-7H3 |
| InChIKey | ZPYHJEJAQLVBAF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|