C19H19F2N3O3 — CID 142710891
[(2S)-3-[2-fluoro-4-(6-fluoro-3-pyridinyl)phenyl]-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]carbamic acid (PubChem CID 142710891) has the molecular formula C19H19F2N3O3 and a molecular weight of 375.38 g/mol. Its IUPAC name is [(2S)-3-[2-fluoro-4-(6-fluoro-3-pyridinyl)phenyl]-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]carbamic acid.
| Compound Name | [(2S)-3-[2-fluoro-4-(6-fluoro-3-pyridinyl)phenyl]-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 142710891 |
| Molecular Formula | C19H19F2N3O3 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | [(2S)-3-[2-fluoro-4-(6-fluoro-3-pyridinyl)phenyl]-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H](Cc1ccc(-c2ccc(F)nc2)cc1F)C(=O)N1CCCC1 |
| InChI | InChI=1S/C19H19F2N3O3/c20-15-9-12(14-5-6-17(21)22-11-14)3-4-13(15)10-16(23-19(26)27)18(25)24-7-1-2-8-24/h3-6,9,11,16,23H,1-2,7-8,10H2,(H,26,27)/t16-/m0/s1 |
| InChIKey | MLQRKSBJEBBSNR-INIZCTEOSA-N |
| XLogP | 2.83 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|