About [(2S)-1-(3,3-difluoropyrrolidin-1-yl)-3-(2-fluoro-4-hydroxyphenyl)-1-oxopropan-2-yl]carbamic acid
[(2S)-1-(3,3-difluoropyrrolidin-1-yl)-3-(2-fluoro-4-hydroxyphenyl)-1-oxopropan-2-yl]carbamic acid (PubChem CID 142710930) has the molecular formula C14H15F3N2O4
and a molecular weight of 332.28 g/mol. Its IUPAC name is [(2S)-1-(3,3-difluoropyrrolidin-1-yl)-3-(2-fluoro-4-hydroxyphenyl)-1-oxopropan-2-yl]carbamic acid.
Molecular Properties
| Compound Name | [(2S)-1-(3,3-difluoropyrrolidin-1-yl)-3-(2-fluoro-4-hydroxyphenyl)-1-oxopropan-2-yl]carbamic acid |
| PubChem CID | 142710930 |
| Molecular Formula | C14H15F3N2O4 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | [(2S)-1-(3,3-difluoropyrrolidin-1-yl)-3-(2-fluoro-4-hydroxyphenyl)-1-oxopropan-2-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H](Cc1ccc(O)cc1F)C(=O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C14H15F3N2O4/c15-10-6-9(20)2-1-8(10)5-11(18-13(22)23)12(21)19-4-3-14(16,17)7-19/h1-2,6,11,18,20H,3-5,7H2,(H,22,23)/t11-/m0/s1 |
| InChIKey | PQEQOTNSZPJTEW-NSHDSACASA-N |
| XLogP | 1.58 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-1-(3,3-difluoropyrrolidin-1-yl)-3-(2-fluoro-4-hydroxyphenyl)-1-oxopropan-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-(3,3-difluoropyrrolidin-1-yl)-3-(2-fluoro-4-hydroxyphenyl)-1-oxopropan-2-yl]carbamic acid?
The IUPAC name of [(2S)-1-(3,3-difluoropyrrolidin-1-yl)-3-(2-fluoro-4-hydroxyphenyl)-1-oxopropan-2-yl]carbamic acid (CID 142710930) is [(2S)-1-(3,3-difluoropyrrolidin-1-yl)-3-(2-fluoro-4-hydroxyphenyl)-1-oxopropan-2-yl]carbamic acid.
What is the SMILES notation for [(2S)-1-(3,3-difluoropyrrolidin-1-yl)-3-(2-fluoro-4-hydroxyphenyl)-1-oxopropan-2-yl]carbamic acid?
The canonical SMILES for [(2S)-1-(3,3-difluoropyrrolidin-1-yl)-3-(2-fluoro-4-hydroxyphenyl)-1-oxopropan-2-yl]carbamic acid is O=C(O)N[C@@H](Cc1ccc(O)cc1F)C(=O)N1CCC(F)(F)C1.
What is the InChIKey of [(2S)-1-(3,3-difluoropyrrolidin-1-yl)-3-(2-fluoro-4-hydroxyphenyl)-1-oxopropan-2-yl]carbamic acid?
The InChIKey is PQEQOTNSZPJTEW-NSHDSACASA-N. The full InChI is InChI=1S/C14H15F3N2O4/c15-10-6-9(20)2-1-8(10)5-11(18-13(22)23)12(21)19-4-3-14(16,17)7-19/h1-2,6,11,18,20H,3-5,7H2,(H,22,23)/t11-/m0/s1.
What are the key properties of [(2S)-1-(3,3-difluoropyrrolidin-1-yl)-3-(2-fluoro-4-hydroxyphenyl)-1-oxopropan-2-yl]carbamic acid?
[(2S)-1-(3,3-difluoropyrrolidin-1-yl)-3-(2-fluoro-4-hydroxyphenyl)-1-oxopropan-2-yl]carbamic acid has a molecular weight of 332.28 g/mol, XLogP of 1.58, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-(3,3-difluoropyrrolidin-1-yl)-3-(2-fluoro-4-hydroxyphenyl)-1-oxopropan-2-yl]carbamic acid is sourced from PubChem (CID 142710930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).