About 2-[2-(2,3,5-trimethylheptan-3-yloxy)propoxy]propan-1-ol
2-[2-(2,3,5-trimethylheptan-3-yloxy)propoxy]propan-1-ol (PubChem CID 142712710) has the molecular formula C16H34O3
and a molecular weight of 274.44 g/mol. Its IUPAC name is 2-[2-(2,3,5-trimethylheptan-3-yloxy)propoxy]propan-1-ol.
Molecular Properties
| Compound Name | 2-[2-(2,3,5-trimethylheptan-3-yloxy)propoxy]propan-1-ol |
| PubChem CID | 142712710 |
| Molecular Formula | C16H34O3 |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.25 |
| IUPAC Name | 2-[2-(2,3,5-trimethylheptan-3-yloxy)propoxy]propan-1-ol |
| SMILES | CCC(C)CC(C)(OC(C)COC(C)CO)C(C)C |
| InChI | InChI=1S/C16H34O3/c1-8-13(4)9-16(7,12(2)3)19-15(6)11-18-14(5)10-17/h12-15,17H,8-11H2,1-7H3 |
| InChIKey | RHYINKHYZYRALG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(2,3,5-trimethylheptan-3-yloxy)propoxy]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,3,5-trimethylheptan-3-yloxy)propoxy]propan-1-ol?
The IUPAC name of 2-[2-(2,3,5-trimethylheptan-3-yloxy)propoxy]propan-1-ol (CID 142712710) is 2-[2-(2,3,5-trimethylheptan-3-yloxy)propoxy]propan-1-ol.
What is the SMILES notation for 2-[2-(2,3,5-trimethylheptan-3-yloxy)propoxy]propan-1-ol?
The canonical SMILES for 2-[2-(2,3,5-trimethylheptan-3-yloxy)propoxy]propan-1-ol is CCC(C)CC(C)(OC(C)COC(C)CO)C(C)C.
What is the InChIKey of 2-[2-(2,3,5-trimethylheptan-3-yloxy)propoxy]propan-1-ol?
The InChIKey is RHYINKHYZYRALG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O3/c1-8-13(4)9-16(7,12(2)3)19-15(6)11-18-14(5)10-17/h12-15,17H,8-11H2,1-7H3.
What are the key properties of 2-[2-(2,3,5-trimethylheptan-3-yloxy)propoxy]propan-1-ol?
2-[2-(2,3,5-trimethylheptan-3-yloxy)propoxy]propan-1-ol has a molecular weight of 274.44 g/mol, XLogP of 3.64, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,3,5-trimethylheptan-3-yloxy)propoxy]propan-1-ol is sourced from PubChem (CID 142712710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).