C15H32O3 — CID 142712602
2-[2-(2,2,4-trimethylhexan-3-yloxy)propoxy]propan-1-ol (PubChem CID 142712602) has the molecular formula C15H32O3 and a molecular weight of 260.42 g/mol. Its IUPAC name is 2-[2-(2,2,4-trimethylhexan-3-yloxy)propoxy]propan-1-ol.
| Compound Name | 2-[2-(2,2,4-trimethylhexan-3-yloxy)propoxy]propan-1-ol |
|---|---|
| PubChem CID | 142712602 |
| Molecular Formula | C15H32O3 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.24 |
| IUPAC Name | 2-[2-(2,2,4-trimethylhexan-3-yloxy)propoxy]propan-1-ol |
| SMILES | CCC(C)C(OC(C)COC(C)CO)C(C)(C)C |
| InChI | InChI=1S/C15H32O3/c1-8-11(2)14(15(5,6)7)18-13(4)10-17-12(3)9-16/h11-14,16H,8-10H2,1-7H3 |
| InChIKey | ZIGWZZWWAMVGEF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |