C16H24N2O3 — CID 142714254
ethyl (2S)-2-(2-benzoylhydrazinyl)-3,3-dimethylpentanoate (PubChem CID 142714254) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is ethyl (2S)-2-(2-benzoylhydrazinyl)-3,3-dimethylpentanoate.
| Compound Name | ethyl (2S)-2-(2-benzoylhydrazinyl)-3,3-dimethylpentanoate |
|---|---|
| PubChem CID | 142714254 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | ethyl (2S)-2-(2-benzoylhydrazinyl)-3,3-dimethylpentanoate |
| SMILES | CCOC(=O)[C@@H](NNC(=O)c1ccccc1)C(C)(C)CC |
| InChI | InChI=1S/C16H24N2O3/c1-5-16(3,4)13(15(20)21-6-2)17-18-14(19)12-10-8-7-9-11-12/h7-11,13,17H,5-6H2,1-4H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | OOHBSAOJJZXOPJ-CYBMUJFWSA-N |
| XLogP | 2.29 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|