C12H22O3 — CID 142714403
(E)-8-(2-methyl-1,3-dioxolan-2-yl)oct-2-en-1-ol (PubChem CID 142714403) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (E)-8-(2-methyl-1,3-dioxolan-2-yl)oct-2-en-1-ol.
| Compound Name | (E)-8-(2-methyl-1,3-dioxolan-2-yl)oct-2-en-1-ol |
|---|---|
| PubChem CID | 142714403 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (E)-8-(2-methyl-1,3-dioxolan-2-yl)oct-2-en-1-ol |
| SMILES | CC1(CCCCC/C=C/CO)OCCO1 |
| InChI | InChI=1S/C12H22O3/c1-12(14-10-11-15-12)8-6-4-2-3-5-7-9-13/h5,7,13H,2-4,6,8-11H2,1H3/b7-5+ |
| InChIKey | DWQZSPQCXAZNOT-FNORWQNLSA-N |
| XLogP | 2.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|