C16H28O5 — CID 11558486
(E,6R)-6-[(2R,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxan-2-yl]hex-2-ene-1,6-diol (PubChem CID 11558486) has the molecular formula C16H28O5 and a molecular weight of 300.39 g/mol. Its IUPAC name is (E,6R)-6-[(2R,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxan-2-yl]hex-2-ene-1,6-diol.
| Compound Name | (E,6R)-6-[(2R,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxan-2-yl]hex-2-ene-1,6-diol |
|---|---|
| PubChem CID | 11558486 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (E,6R)-6-[(2R,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxan-2-yl]hex-2-ene-1,6-diol |
| SMILES | CC1(C)OC[C@H]([C@@H]2CCC[C@H]([C@H](O)CC/C=C/CO)O2)O1 |
| InChI | InChI=1S/C16H28O5/c1-16(2)19-11-15(21-16)14-9-6-8-13(20-14)12(18)7-4-3-5-10-17/h3,5,12-15,17-18H,4,6-11H2,1-2H3/b5-3+/t12-,13-,14+,15-/m1/s1 |
| InChIKey | WVIAKYCKGWSMBG-LUGGRYCLSA-N |
| XLogP | 1.77 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|